C22H26FN5O — CID 123923344
N-butyl-5-(4-fluorophenyl)-7-(4-nitrosocyclohexyl)pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 123923344) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is N-butyl-5-(4-fluorophenyl)-7-(4-nitrosocyclohexyl)pyrrolo[3,2-d]pyrimidin-2-amine.
| Compound Name | N-butyl-5-(4-fluorophenyl)-7-(4-nitrosocyclohexyl)pyrrolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 123923344 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-butyl-5-(4-fluorophenyl)-7-(4-nitrosocyclohexyl)pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | CCCCNc1ncc2c(n1)c(C1CCC(N=O)CC1)cn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN5O/c1-2-3-12-24-22-25-13-20-21(26-22)19(15-4-8-17(27-29)9-5-15)14-28(20)18-10-6-16(23)7-11-18/h6-7,10-11,13-15,17H,2-5,8-9,12H2,1H3,(H,24,25,26) |
| InChIKey | HOXHSSASYMWKIZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|