C27H37N7O2 — CID 126569591
[4-[2-(butylamino)-5-(4-piperazin-1-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl] acetate (PubChem CID 126569591) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is [4-[2-(butylamino)-5-(4-piperazin-1-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl] acetate.
| Compound Name | [4-[2-(butylamino)-5-(4-piperazin-1-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 126569591 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | [4-[2-(butylamino)-5-(4-piperazin-1-ylphenyl)imidazo[5,1-f][1,2,4]triazin-7-yl]cyclohexyl] acetate |
| SMILES | CCCCNc1ncc2c(-c3ccc(N4CCNCC4)cc3)nc(C3CCC(OC(C)=O)CC3)n2n1 |
| InChI | InChI=1S/C27H37N7O2/c1-3-4-13-29-27-30-18-24-25(20-5-9-22(10-6-20)33-16-14-28-15-17-33)31-26(34(24)32-27)21-7-11-23(12-8-21)36-19(2)35/h5-6,9-10,18,21,23,28H,3-4,7-8,11-17H2,1-2H3,(H,29,32) |
| InChIKey | ZBNYJYVCJYDLBA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|