C31H39N7 — CID 144944070
1-(cyclohexylmethyl)-N-(3-phenylpropyl)-3-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 144944070) has the molecular formula C31H39N7 and a molecular weight of 509.70 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N-(3-phenylpropyl)-3-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-(cyclohexylmethyl)-N-(3-phenylpropyl)-3-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 144944070 |
| Molecular Formula | C31H39N7 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 1-(cyclohexylmethyl)-N-(3-phenylpropyl)-3-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | c1ccc(CCCNc2ncc3c(-c4ccc(N5CCNCC5)cc4)nn(CC4CCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C31H39N7/c1-3-8-24(9-4-1)12-7-17-33-31-34-22-28-29(26-13-15-27(16-14-26)37-20-18-32-19-21-37)36-38(30(28)35-31)23-25-10-5-2-6-11-25/h1,3-4,8-9,13-16,22,25,32H,2,5-7,10-12,17-21,23H2,(H,33,34,35) |
| InChIKey | OBSXBVQZJAWTEZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|