C19H24FN5O — CID 123790584
4-[2-(butylamino)-5-(5-fluoro-2-pyridinyl)pyrimidin-4-yl]iminocyclohexan-1-ol (PubChem CID 123790584) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-(5-fluoro-2-pyridinyl)pyrimidin-4-yl]iminocyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-(5-fluoro-2-pyridinyl)pyrimidin-4-yl]iminocyclohexan-1-ol |
|---|---|
| PubChem CID | 123790584 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-[2-(butylamino)-5-(5-fluoro-2-pyridinyl)pyrimidin-4-yl]iminocyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(F)cn2)c(N=C2CCC(O)CC2)n1 |
| InChI | InChI=1S/C19H24FN5O/c1-2-3-10-21-19-23-12-16(17-9-4-13(20)11-22-17)18(25-19)24-14-5-7-15(26)8-6-14/h4,9,11-12,15,26H,2-3,5-8,10H2,1H3,(H,21,23,25)/b24-14- |
| InChIKey | PCEQSNRCUACAIR-OYKKKHCWSA-N |
| XLogP | 3.90 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|