C24H34N6O2 — CID 123295770
4-[2-(butylamino)-5-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]iminocyclohexan-1-ol (PubChem CID 123295770) has the molecular formula C24H34N6O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]iminocyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]iminocyclohexan-1-ol |
|---|---|
| PubChem CID | 123295770 |
| Molecular Formula | C24H34N6O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 4-[2-(butylamino)-5-[5-(morpholin-4-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]iminocyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CN3CCOCC3)cn2)c(N=C2CCC(O)CC2)n1 |
| InChI | InChI=1S/C24H34N6O2/c1-2-3-10-25-24-27-16-21(23(29-24)28-19-5-7-20(31)8-6-19)22-9-4-18(15-26-22)17-30-11-13-32-14-12-30/h4,9,15-16,20,31H,2-3,5-8,10-14,17H2,1H3,(H,25,27,29)/b28-19- |
| InChIKey | WGCQUKDGFLVQOA-USHMODERSA-N |
| XLogP | 3.59 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|