C15H15FN6 — CID 46847294
N-butyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine (PubChem CID 46847294) has the molecular formula C15H15FN6 and a molecular weight of 298.32 g/mol. Its IUPAC name is N-butyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine.
| Compound Name | N-butyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine |
|---|---|
| PubChem CID | 46847294 |
| Molecular Formula | C15H15FN6 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-butyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine |
| SMILES | CCCCNc1ncc2nc(-c3ccc(F)cc3)nnc2n1 |
| InChI | InChI=1S/C15H15FN6/c1-2-3-8-17-15-18-9-12-14(20-15)22-21-13(19-12)10-4-6-11(16)7-5-10/h4-7,9H,2-3,8H2,1H3,(H,17,18,20,22) |
| InChIKey | PVRRMCRRQKEACS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|