C18H13FN6 — CID 46847192
N-benzyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine (PubChem CID 46847192) has the molecular formula C18H13FN6 and a molecular weight of 332.34 g/mol. Its IUPAC name is N-benzyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine.
| Compound Name | N-benzyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine |
|---|---|
| PubChem CID | 46847192 |
| Molecular Formula | C18H13FN6 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-benzyl-3-(4-fluorophenyl)pyrimido[5,4-e][1,2,4]triazin-7-amine |
| SMILES | Fc1ccc(-c2nnc3nc(NCc4ccccc4)ncc3n2)cc1 |
| InChI | InChI=1S/C18H13FN6/c19-14-8-6-13(7-9-14)16-22-15-11-21-18(23-17(15)25-24-16)20-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,20,21,23,25) |
| InChIKey | RYNFVGJNDDOCPO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |