C8H12FN3O2S — CID 115749979
5-fluoro-N-(3-methylsulfonylpropyl)pyrimidin-2-amine (PubChem CID 115749979) has the molecular formula C8H12FN3O2S and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-fluoro-N-(3-methylsulfonylpropyl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-(3-methylsulfonylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115749979 |
| Molecular Formula | C8H12FN3O2S |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-fluoro-N-(3-methylsulfonylpropyl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)CCCNc1ncc(F)cn1 |
| InChI | InChI=1S/C8H12FN3O2S/c1-15(13,14)4-2-3-10-8-11-5-7(9)6-12-8/h5-6H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | QWDTXHGMAZMUPQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|