C10H17N3O2S — CID 104533920
3-N-methyl-5-N-(3-methylsulfonylpropyl)pyridine-3,5-diamine (PubChem CID 104533920) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-N-methyl-5-N-(3-methylsulfonylpropyl)pyridine-3,5-diamine.
| Compound Name | 3-N-methyl-5-N-(3-methylsulfonylpropyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104533920 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-N-methyl-5-N-(3-methylsulfonylpropyl)pyridine-3,5-diamine |
| SMILES | CNc1cncc(NCCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H17N3O2S/c1-11-9-6-10(8-12-7-9)13-4-3-5-16(2,14)15/h6-8,11,13H,3-5H2,1-2H3 |
| InChIKey | ZRPREEJSHPPTMZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|