C11H19N3O2S — CID 114112659
3-N-ethyl-5-N-(2-ethylsulfonylethyl)pyridine-3,5-diamine (PubChem CID 114112659) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-N-ethyl-5-N-(2-ethylsulfonylethyl)pyridine-3,5-diamine.
| Compound Name | 3-N-ethyl-5-N-(2-ethylsulfonylethyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 114112659 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-N-ethyl-5-N-(2-ethylsulfonylethyl)pyridine-3,5-diamine |
| SMILES | CCNc1cncc(NCCS(=O)(=O)CC)c1 |
| InChI | InChI=1S/C11H19N3O2S/c1-3-13-10-7-11(9-12-8-10)14-5-6-17(15,16)4-2/h7-9,13-14H,3-6H2,1-2H3 |
| InChIKey | SOTQXLNULGDKET-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |