C7H11N3 — CID 104532571
5-N-ethylpyridine-3,5-diamine (PubChem CID 104532571) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 5-N-ethylpyridine-3,5-diamine.
| Compound Name | 5-N-ethylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532571 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 5-N-ethylpyridine-3,5-diamine |
| SMILES | CCNc1cncc(N)c1 |
| InChI | InChI=1S/C7H11N3/c1-2-10-7-3-6(8)4-9-5-7/h3-5,10H,2,8H2,1H3 |
| InChIKey | USOUQAYSUVOENA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |