C8H13N3S — CID 104534747
5-N-(2-methylsulfanylethyl)pyridine-3,5-diamine (PubChem CID 104534747) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 5-N-(2-methylsulfanylethyl)pyridine-3,5-diamine.
| Compound Name | 5-N-(2-methylsulfanylethyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104534747 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5-N-(2-methylsulfanylethyl)pyridine-3,5-diamine |
| SMILES | CSCCNc1cncc(N)c1 |
| InChI | InChI=1S/C8H13N3S/c1-12-3-2-11-8-4-7(9)5-10-6-8/h4-6,11H,2-3,9H2,1H3 |
| InChIKey | SXTBYOWUDFPFCW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|