C15H27N3 — CID 104535317
5-N-decylpyridine-3,5-diamine (PubChem CID 104535317) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 5-N-decylpyridine-3,5-diamine.
| Compound Name | 5-N-decylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104535317 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 5-N-decylpyridine-3,5-diamine |
| SMILES | CCCCCCCCCCNc1cncc(N)c1 |
| InChI | InChI=1S/C15H27N3/c1-2-3-4-5-6-7-8-9-10-18-15-11-14(16)12-17-13-15/h11-13,18H,2-10,16H2,1H3 |
| InChIKey | HANIYQWESOURDE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|