C12H15N3S — CID 106015386
5-N-[(5-ethylthiophen-2-yl)methyl]pyridine-3,5-diamine (PubChem CID 106015386) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 5-N-[(5-ethylthiophen-2-yl)methyl]pyridine-3,5-diamine.
| Compound Name | 5-N-[(5-ethylthiophen-2-yl)methyl]pyridine-3,5-diamine |
|---|---|
| PubChem CID | 106015386 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-N-[(5-ethylthiophen-2-yl)methyl]pyridine-3,5-diamine |
| SMILES | CCc1ccc(CNc2cncc(N)c2)s1 |
| InChI | InChI=1S/C12H15N3S/c1-2-11-3-4-12(16-11)8-15-10-5-9(13)6-14-7-10/h3-7,15H,2,8,13H2,1H3 |
| InChIKey | VDUAPXBSBAUZRB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |