C9H15N3 — CID 104532548
5-N-butan-2-ylpyridine-3,5-diamine (PubChem CID 104532548) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-N-butan-2-ylpyridine-3,5-diamine.
| Compound Name | 5-N-butan-2-ylpyridine-3,5-diamine |
|---|---|
| PubChem CID | 104532548 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 5-N-butan-2-ylpyridine-3,5-diamine |
| SMILES | CCC(C)Nc1cncc(N)c1 |
| InChI | InChI=1S/C9H15N3/c1-3-7(2)12-9-4-8(10)5-11-6-9/h4-7,12H,3,10H2,1-2H3 |
| InChIKey | NFCNMAYJQRSNFQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |