C6H9FN4 — CID 112703775
N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 112703775) has the molecular formula C6H9FN4 and a molecular weight of 156.16 g/mol. Its IUPAC name is N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 112703775 |
| Molecular Formula | C6H9FN4 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | N'-(5-fluoropyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | NCCNc1ncc(F)cn1 |
| InChI | InChI=1S/C6H9FN4/c7-5-3-10-6(11-4-5)9-2-1-8/h3-4H,1-2,8H2,(H,9,10,11) |
| InChIKey | YHZHOCBFNHZPNF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |