C8H12FN3O — CID 115750155
4-[(5-fluoropyrimidin-2-yl)amino]butan-2-ol (PubChem CID 115750155) has the molecular formula C8H12FN3O and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-[(5-fluoropyrimidin-2-yl)amino]butan-2-ol.
| Compound Name | 4-[(5-fluoropyrimidin-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 115750155 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-[(5-fluoropyrimidin-2-yl)amino]butan-2-ol |
| SMILES | CC(O)CCNc1ncc(F)cn1 |
| InChI | InChI=1S/C8H12FN3O/c1-6(13)2-3-10-8-11-4-7(9)5-12-8/h4-6,13H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | AMTQYTLOMXEUDZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |