C9H14BrN3O — CID 107269196
5-[(5-bromopyrimidin-2-yl)amino]pentan-2-ol (PubChem CID 107269196) has the molecular formula C9H14BrN3O and a molecular weight of 260.13 g/mol. Its IUPAC name is 5-[(5-bromopyrimidin-2-yl)amino]pentan-2-ol.
| Compound Name | 5-[(5-bromopyrimidin-2-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 107269196 |
| Molecular Formula | C9H14BrN3O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 5-[(5-bromopyrimidin-2-yl)amino]pentan-2-ol |
| SMILES | CC(O)CCCNc1ncc(Br)cn1 |
| InChI | InChI=1S/C9H14BrN3O/c1-7(14)3-2-4-11-9-12-5-8(10)6-13-9/h5-7,14H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | VAYODYJUGMWMLD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|