C10H14FN3O2 — CID 104606017
5-[(5-fluoropyrimidin-2-yl)amino]-4-methylpentanoic acid (PubChem CID 104606017) has the molecular formula C10H14FN3O2 and a molecular weight of 227.24 g/mol. Its IUPAC name is 5-[(5-fluoropyrimidin-2-yl)amino]-4-methylpentanoic acid.
| Compound Name | 5-[(5-fluoropyrimidin-2-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 104606017 |
| Molecular Formula | C10H14FN3O2 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 5-[(5-fluoropyrimidin-2-yl)amino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNc1ncc(F)cn1 |
| InChI | InChI=1S/C10H14FN3O2/c1-7(2-3-9(15)16)4-12-10-13-5-8(11)6-14-10/h5-7H,2-4H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | DQUOPXQGDKLOJO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |