C7H10FN3O — CID 115749831
1-[(5-fluoropyrimidin-2-yl)amino]propan-2-ol (PubChem CID 115749831) has the molecular formula C7H10FN3O and a molecular weight of 171.18 g/mol. Its IUPAC name is 1-[(5-fluoropyrimidin-2-yl)amino]propan-2-ol.
| Compound Name | 1-[(5-fluoropyrimidin-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 115749831 |
| Molecular Formula | C7H10FN3O |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-[(5-fluoropyrimidin-2-yl)amino]propan-2-ol |
| SMILES | CC(O)CNc1ncc(F)cn1 |
| InChI | InChI=1S/C7H10FN3O/c1-5(12)2-9-7-10-3-6(8)4-11-7/h3-5,12H,2H2,1H3,(H,9,10,11) |
| InChIKey | FSWFSGKDYVSJEA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |