C8H13FN4O — CID 80779218
1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propan-2-ol (PubChem CID 80779218) has the molecular formula C8H13FN4O and a molecular weight of 200.22 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propan-2-ol.
| Compound Name | 1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 80779218 |
| Molecular Formula | C8H13FN4O |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]propan-2-ol |
| SMILES | CNc1ncc(F)c(NCC(C)O)n1 |
| InChI | InChI=1S/C8H13FN4O/c1-5(14)3-11-7-6(9)4-12-8(10-2)13-7/h4-5,14H,3H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | GXMQAOODERKRAI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |