C9H15FN4O — CID 80841199
1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropan-2-ol (PubChem CID 80841199) has the molecular formula C9H15FN4O and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 80841199 |
| Molecular Formula | C9H15FN4O |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-2-methylpropan-2-ol |
| SMILES | CNc1ncc(F)c(NCC(C)(C)O)n1 |
| InChI | InChI=1S/C9H15FN4O/c1-9(2,15)5-13-7-6(10)4-12-8(11-3)14-7/h4,15H,5H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | GDIIDISFANFBGS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |