C10H17FN4O2 — CID 106248733
4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol (PubChem CID 106248733) has the molecular formula C10H17FN4O2 and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol.
| Compound Name | 4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106248733 |
| Molecular Formula | C10H17FN4O2 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-[[5-fluoro-2-(methylamino)pyrimidin-4-yl]amino]-1-methoxybutan-2-ol |
| SMILES | CNc1ncc(F)c(NCCC(O)COC)n1 |
| InChI | InChI=1S/C10H17FN4O2/c1-12-10-14-5-8(11)9(15-10)13-4-3-7(16)6-17-2/h5,7,16H,3-4,6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | PQOAWGGPRJSUDS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |