C10H16F2N4O2 — CID 106249041
4-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-1-methoxybutan-2-ol (PubChem CID 106249041) has the molecular formula C10H16F2N4O2 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-1-methoxybutan-2-ol.
| Compound Name | 4-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106249041 |
| Molecular Formula | C10H16F2N4O2 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNc1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C10H16F2N4O2/c1-18-5-6(17)2-3-14-9-7(11)4-8(12)10(15-9)16-13/h4,6,17H,2-3,5,13H2,1H3,(H2,14,15,16) |
| InChIKey | FCBOBVSNKBLTJI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|