C10H19N5O3 — CID 106249050
4-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-1-methoxybutan-2-ol (PubChem CID 106249050) has the molecular formula C10H19N5O3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-1-methoxybutan-2-ol.
| Compound Name | 4-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 106249050 |
| Molecular Formula | C10H19N5O3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 4-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNc1ncnc(NN)c1OC |
| InChI | InChI=1S/C10H19N5O3/c1-17-5-7(16)3-4-12-9-8(18-2)10(15-11)14-6-13-9/h6-7,16H,3-5,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | KKLOAPRRPCQDKX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|