C8H14N6O3 — CID 106179516
3-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-2-hydroxypropanamide (PubChem CID 106179516) has the molecular formula C8H14N6O3 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106179516 |
| Molecular Formula | C8H14N6O3 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[(6-hydrazinyl-5-methoxypyrimidin-4-yl)amino]-2-hydroxypropanamide |
| SMILES | COc1c(NN)ncnc1NCC(O)C(N)=O |
| InChI | InChI=1S/C8H14N6O3/c1-17-5-7(11-2-4(15)6(9)16)12-3-13-8(5)14-10/h3-4,15H,2,10H2,1H3,(H2,9,16)(H2,11,12,13,14) |
| InChIKey | DIRCSRLNZAWDDC-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|