C7H9ClN4O2 — CID 106170483
3-[(5-chloropyrimidin-4-yl)amino]-2-hydroxypropanamide (PubChem CID 106170483) has the molecular formula C7H9ClN4O2 and a molecular weight of 216.63 g/mol. Its IUPAC name is 3-[(5-chloropyrimidin-4-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(5-chloropyrimidin-4-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170483 |
| Molecular Formula | C7H9ClN4O2 |
| Molecular Weight | 216.63 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 3-[(5-chloropyrimidin-4-yl)amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1ncncc1Cl |
| InChI | InChI=1S/C7H9ClN4O2/c8-4-1-10-3-12-7(4)11-2-5(13)6(9)14/h1,3,5,13H,2H2,(H2,9,14)(H,10,11,12) |
| InChIKey | AWECBDFYQAEQPA-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.63 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |