C9H14ClN3O2 — CID 102975966
5-chloro-N-(2,3-dimethoxypropyl)pyrimidin-4-amine (PubChem CID 102975966) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dimethoxypropyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(2,3-dimethoxypropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 102975966 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 5-chloro-N-(2,3-dimethoxypropyl)pyrimidin-4-amine |
| SMILES | COCC(CNc1ncncc1Cl)OC |
| InChI | InChI=1S/C9H14ClN3O2/c1-14-5-7(15-2)3-12-9-8(10)4-11-6-13-9/h4,6-7H,3,5H2,1-2H3,(H,11,12,13) |
| InChIKey | IIRZEAQMOHLCAA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |