C11H19ClN4 — CID 106286982
1-N-(5-chloropyrimidin-4-yl)-3-ethylpentane-1,2-diamine (PubChem CID 106286982) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-N-(5-chloropyrimidin-4-yl)-3-ethylpentane-1,2-diamine.
| Compound Name | 1-N-(5-chloropyrimidin-4-yl)-3-ethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 106286982 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-N-(5-chloropyrimidin-4-yl)-3-ethylpentane-1,2-diamine |
| SMILES | CCC(CC)C(N)CNc1ncncc1Cl |
| InChI | InChI=1S/C11H19ClN4/c1-3-8(4-2)10(13)6-15-11-9(12)5-14-7-16-11/h5,7-8,10H,3-4,6,13H2,1-2H3,(H,14,15,16) |
| InChIKey | CSJVYHDTKLKIHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |