C11H16ClN3O2 — CID 100662469
ethyl (2S,3R)-3-[(5-chloropyrimidin-4-yl)amino]-2-methylbutanoate (PubChem CID 100662469) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[(5-chloropyrimidin-4-yl)amino]-2-methylbutanoate.
| Compound Name | ethyl (2S,3R)-3-[(5-chloropyrimidin-4-yl)amino]-2-methylbutanoate |
|---|---|
| PubChem CID | 100662469 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | ethyl (2S,3R)-3-[(5-chloropyrimidin-4-yl)amino]-2-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@@H](C)Nc1ncncc1Cl |
| InChI | InChI=1S/C11H16ClN3O2/c1-4-17-11(16)7(2)8(3)15-10-9(12)5-13-6-14-10/h5-8H,4H2,1-3H3,(H,13,14,15)/t7-,8+/m0/s1 |
| InChIKey | IUKOHDMFYSTVRZ-JGVFFNPUSA-N |
| XLogP | 2.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |