C9H13ClN4O — CID 102975980
2-[(5-chloropyrimidin-4-yl)amino]-N-ethyl-N-methylacetamide (PubChem CID 102975980) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 2-[(5-chloropyrimidin-4-yl)amino]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[(5-chloropyrimidin-4-yl)amino]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 102975980 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[(5-chloropyrimidin-4-yl)amino]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CNc1ncncc1Cl |
| InChI | InChI=1S/C9H13ClN4O/c1-3-14(2)8(15)5-12-9-7(10)4-11-6-13-9/h4,6H,3,5H2,1-2H3,(H,11,12,13) |
| InChIKey | APPGLXWBQVQHRN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |