C9H15ClN4 — CID 105369876
N'-(5-chloropyrimidin-4-yl)-N-ethylpropane-1,3-diamine (PubChem CID 105369876) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is N'-(5-chloropyrimidin-4-yl)-N-ethylpropane-1,3-diamine.
| Compound Name | N'-(5-chloropyrimidin-4-yl)-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 105369876 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N'-(5-chloropyrimidin-4-yl)-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNc1ncncc1Cl |
| InChI | InChI=1S/C9H15ClN4/c1-2-11-4-3-5-13-9-8(10)6-12-7-14-9/h6-7,11H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | NNMTVWVYMFZIDC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|