C13H21ClN4 — CID 105370083
N'-(5-chloropyrimidin-4-yl)-N-cycloheptylethane-1,2-diamine (PubChem CID 105370083) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is N'-(5-chloropyrimidin-4-yl)-N-cycloheptylethane-1,2-diamine.
| Compound Name | N'-(5-chloropyrimidin-4-yl)-N-cycloheptylethane-1,2-diamine |
|---|---|
| PubChem CID | 105370083 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N'-(5-chloropyrimidin-4-yl)-N-cycloheptylethane-1,2-diamine |
| SMILES | Clc1cncnc1NCCNC1CCCCCC1 |
| InChI | InChI=1S/C13H21ClN4/c14-12-9-15-10-18-13(12)17-8-7-16-11-5-3-1-2-4-6-11/h9-11,16H,1-8H2,(H,15,17,18) |
| InChIKey | YKCXERXCVKZOID-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|