C14H22N6 — CID 78990142
N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 78990142) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine.
| Compound Name | N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 78990142 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | c1nc(NCCNC2CCCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H22N6/c1-2-4-6-11(5-3-1)15-7-8-16-13-12-14(18-9-17-12)20-10-19-13/h9-11,15H,1-8H2,(H2,16,17,18,19,20) |
| InChIKey | ZNZQDYMFUKEUNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|