About N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine
N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 78990142) has the molecular formula C14H22N6
and a molecular weight of 274.37 g/mol. Its IUPAC name is N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| PubChem CID | 78990142 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | c1nc(NCCNC2CCCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H22N6/c1-2-4-6-11(5-3-1)15-7-8-16-13-12-14(18-9-17-12)20-10-19-13/h9-11,15H,1-8H2,(H2,16,17,18,19,20) |
| InChIKey | ZNZQDYMFUKEUNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine?
The IUPAC name of N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine (CID 78990142) is N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine.
What is the SMILES notation for N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine?
The canonical SMILES for N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine is c1nc(NCCNC2CCCCCC2)c2[nH]cnc2n1.
What is the InChIKey of N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine?
The InChIKey is ZNZQDYMFUKEUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6/c1-2-4-6-11(5-3-1)15-7-8-16-13-12-14(18-9-17-12)20-10-19-13/h9-11,15H,1-8H2,(H2,16,17,18,19,20).
What are the key properties of N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine?
N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine has a molecular weight of 274.37 g/mol, XLogP of 2.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-N'-(7H-purin-6-yl)ethane-1,2-diamine is sourced from PubChem (CID 78990142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).