C19H24N6 — CID 60504397
N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-6-amine (PubChem CID 60504397) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-6-amine.
| Compound Name | N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 60504397 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N-[[2-[(2-methylpiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-6-amine |
| SMILES | CC1CCCCN1Cc1ccccc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C19H24N6/c1-14-6-4-5-9-25(14)11-16-8-3-2-7-15(16)10-20-18-17-19(22-12-21-17)24-13-23-18/h2-3,7-8,12-14H,4-6,9-11H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | BXGKKDZYLYZRAC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |