C12H11N5O3S — CID 87748569
2-[(7H-purin-6-ylamino)methyl]benzenesulfonic acid (PubChem CID 87748569) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-[(7H-purin-6-ylamino)methyl]benzenesulfonic acid.
| Compound Name | 2-[(7H-purin-6-ylamino)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87748569 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[(7H-purin-6-ylamino)methyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H11N5O3S/c18-21(19,20)9-4-2-1-3-8(9)5-13-11-10-12(15-6-14-10)17-7-16-11/h1-4,6-7H,5H2,(H,18,19,20)(H2,13,14,15,16,17) |
| InChIKey | MXRKRIWYTXSKRU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|