C11H9N5O3S — CID 22147127
4-(7H-purin-6-ylamino)benzenesulfonic acid (PubChem CID 22147127) has the molecular formula C11H9N5O3S and a molecular weight of 291.29 g/mol. Its IUPAC name is 4-(7H-purin-6-ylamino)benzenesulfonic acid.
| Compound Name | 4-(7H-purin-6-ylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 22147127 |
| Molecular Formula | C11H9N5O3S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-(7H-purin-6-ylamino)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Nc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C11H9N5O3S/c17-20(18,19)8-3-1-7(2-4-8)16-11-9-10(13-5-12-9)14-6-15-11/h1-6H,(H,17,18,19)(H2,12,13,14,15,16) |
| InChIKey | YTWHFSJHDVXSGN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|