C17H13N5O2S — CID 122531268
4-phenyl-N-(7H-purin-6-yl)benzenesulfonamide (PubChem CID 122531268) has the molecular formula C17H13N5O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is 4-phenyl-N-(7H-purin-6-yl)benzenesulfonamide.
| Compound Name | 4-phenyl-N-(7H-purin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122531268 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-phenyl-N-(7H-purin-6-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncnc2nc[nH]c12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13N5O2S/c23-25(24,22-17-15-16(19-10-18-15)20-11-21-17)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H2,18,19,20,21,22) |
| InChIKey | HJPMBPGZHWWGBA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |