C16H19N5 — CID 69097613
N-[(1S)-2,2-dimethyl-1-phenylpropyl]-7H-purin-6-amine (PubChem CID 69097613) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(1S)-2,2-dimethyl-1-phenylpropyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-2,2-dimethyl-1-phenylpropyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 69097613 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(1S)-2,2-dimethyl-1-phenylpropyl]-7H-purin-6-amine |
| SMILES | CC(C)(C)[C@H](Nc1ncnc2nc[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C16H19N5/c1-16(2,3)13(11-7-5-4-6-8-11)21-15-12-14(18-9-17-12)19-10-20-15/h4-10,13H,1-3H3,(H2,17,18,19,20,21)/t13-/m1/s1 |
| InChIKey | NLQVHNBDYGSGGR-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |