C15H13N7O — CID 136602511
2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one (PubChem CID 136602511) has the molecular formula C15H13N7O and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136602511 |
| Molecular Formula | C15H13N7O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[1-(7H-purin-6-ylamino)ethyl]-3H-quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H13N7O/c1-8(20-14-11-13(17-6-16-11)18-7-19-14)12-21-10-5-3-2-4-9(10)15(23)22-12/h2-8H,1H3,(H,21,22,23)(H2,16,17,18,19,20) |
| InChIKey | YUQGUKPGDVNLCS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |