C21H18N8O — CID 73330998
3-anilino-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 73330998) has the molecular formula C21H18N8O and a molecular weight of 398.43 g/mol. Its IUPAC name is 3-anilino-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 3-anilino-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 73330998 |
| Molecular Formula | C21H18N8O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-anilino-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2ccccc2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C21H18N8O/c1-13(26-19-17-18(23-11-22-17)24-12-25-19)20-27-16-10-6-5-9-15(16)21(30)29(20)28-14-7-3-2-4-8-14/h2-13,28H,1H3,(H2,22,23,24,25,26) |
| InChIKey | KBVUMTMREQFRRO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |