C24H25FN8O — CID 144567018
3-anilino-7-fluoro-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one;ethane (PubChem CID 144567018) has the molecular formula C24H25FN8O and a molecular weight of 460.52 g/mol. Its IUPAC name is 3-anilino-7-fluoro-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one;ethane.
| Compound Name | 3-anilino-7-fluoro-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one;ethane |
|---|---|
| PubChem CID | 144567018 |
| Molecular Formula | C24H25FN8O |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 3-anilino-7-fluoro-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one;ethane |
| SMILES | CC.Cc1cc(F)cc2nc(C(C)Nc3ncnc4nc[nH]c34)n(Nc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C22H19FN8O.C2H6/c1-12-8-14(23)9-16-17(12)22(32)31(30-15-6-4-3-5-7-15)21(29-16)13(2)28-20-18-19(25-10-24-18)26-11-27-20;1-2/h3-11,13,30H,1-2H3,(H2,24,25,26,27,28);1-2H3 |
| InChIKey | FZCSWBOVTHRIKB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |