C22H19ClN8O — CID 90063422
3-anilino-5-chloro-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one (PubChem CID 90063422) has the molecular formula C22H19ClN8O and a molecular weight of 446.90 g/mol. Its IUPAC name is 3-anilino-5-chloro-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one.
| Compound Name | 3-anilino-5-chloro-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 90063422 |
| Molecular Formula | C22H19ClN8O |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-anilino-5-chloro-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1nc2cccc(Cl)c2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C22H19ClN8O/c1-2-15(28-20-18-19(25-11-24-18)26-12-27-20)21-29-16-10-6-9-14(23)17(16)22(32)31(21)30-13-7-4-3-5-8-13/h3-12,15,30H,2H2,1H3,(H2,24,25,26,27,28)/t15-/m0/s1 |
| InChIKey | BDMALJYJFABUKZ-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |