C21H18ClN9O — CID 73331433
5-chloro-2-[1-(7H-purin-6-ylamino)propyl]-3-(pyridin-4-ylamino)quinazolin-4-one (PubChem CID 73331433) has the molecular formula C21H18ClN9O and a molecular weight of 447.89 g/mol. Its IUPAC name is 5-chloro-2-[1-(7H-purin-6-ylamino)propyl]-3-(pyridin-4-ylamino)quinazolin-4-one.
| Compound Name | 5-chloro-2-[1-(7H-purin-6-ylamino)propyl]-3-(pyridin-4-ylamino)quinazolin-4-one |
|---|---|
| PubChem CID | 73331433 |
| Molecular Formula | C21H18ClN9O |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 5-chloro-2-[1-(7H-purin-6-ylamino)propyl]-3-(pyridin-4-ylamino)quinazolin-4-one |
| SMILES | CCC(Nc1ncnc2nc[nH]c12)c1nc2cccc(Cl)c2c(=O)n1Nc1ccncc1 |
| InChI | InChI=1S/C21H18ClN9O/c1-2-14(28-19-17-18(25-10-24-17)26-11-27-19)20-29-15-5-3-4-13(22)16(15)21(32)31(20)30-12-6-8-23-9-7-12/h3-11,14H,2H2,1H3,(H,23,30)(H2,24,25,26,27,28) |
| InChIKey | WYPVAHIUOWHZAA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |