C22H19FN8O — CID 73332633
3-anilino-5-fluoro-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one (PubChem CID 73332633) has the molecular formula C22H19FN8O and a molecular weight of 430.45 g/mol. Its IUPAC name is 3-anilino-5-fluoro-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one.
| Compound Name | 3-anilino-5-fluoro-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 73332633 |
| Molecular Formula | C22H19FN8O |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-anilino-5-fluoro-2-[1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
| SMILES | CCC(Nc1ncnc2nc[nH]c12)c1nc2cccc(F)c2c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C22H19FN8O/c1-2-15(28-20-18-19(25-11-24-18)26-12-27-20)21-29-16-10-6-9-14(23)17(16)22(32)31(21)30-13-7-4-3-5-8-13/h3-12,15,30H,2H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | QJZHQGNPFFMKKE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |