C21H16ClFN8O — CID 73331002
5-chloro-3-(4-fluoroanilino)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 73331002) has the molecular formula C21H16ClFN8O and a molecular weight of 450.87 g/mol. Its IUPAC name is 5-chloro-3-(4-fluoroanilino)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 5-chloro-3-(4-fluoroanilino)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 73331002 |
| Molecular Formula | C21H16ClFN8O |
| Molecular Weight | 450.87 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 5-chloro-3-(4-fluoroanilino)-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2cccc(Cl)c2c(=O)n1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16ClFN8O/c1-11(28-19-17-18(25-9-24-17)26-10-27-19)20-29-15-4-2-3-14(22)16(15)21(32)31(20)30-13-7-5-12(23)6-8-13/h2-11,30H,1H3,(H2,24,25,26,27,28) |
| InChIKey | LAHZVWLHCCVFCL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |