C24H25N8OP — CID 144566844
3-(2,6-dimethyl-4-phosphanylanilino)-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 144566844) has the molecular formula C24H25N8OP and a molecular weight of 472.49 g/mol. Its IUPAC name is 3-(2,6-dimethyl-4-phosphanylanilino)-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 3-(2,6-dimethyl-4-phosphanylanilino)-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 144566844 |
| Molecular Formula | C24H25N8OP |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3-(2,6-dimethyl-4-phosphanylanilino)-5-methyl-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | Cc1cc(P)cc(C)c1Nn1c(C(C)Nc2ncnc3nc[nH]c23)nc2cccc(C)c2c1=O |
| InChI | InChI=1S/C24H25N8OP/c1-12-6-5-7-17-18(12)24(33)32(31-19-13(2)8-16(34)9-14(19)3)23(30-17)15(4)29-22-20-21(26-10-25-20)27-11-28-22/h5-11,15,31H,34H2,1-4H3,(H2,25,26,27,28,29) |
| InChIKey | QENCLEIIZOMOQR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|