C21H14F3N7O — CID 118043712
3-(2,4-difluorophenyl)-5-fluoro-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 118043712) has the molecular formula C21H14F3N7O and a molecular weight of 437.39 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-5-fluoro-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 3-(2,4-difluorophenyl)-5-fluoro-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 118043712 |
| Molecular Formula | C21H14F3N7O |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-(2,4-difluorophenyl)-5-fluoro-2-[1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2cccc(F)c2c(=O)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C21H14F3N7O/c1-10(29-19-17-18(26-8-25-17)27-9-28-19)20-30-14-4-2-3-12(23)16(14)21(32)31(20)15-6-5-11(22)7-13(15)24/h2-10H,1H3,(H2,25,26,27,28,29) |
| InChIKey | YDVZJRMGRAWVJT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |