C18H19FN8O — CID 90063504
3-[ethyl(methyl)amino]-5-fluoro-2-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one (PubChem CID 90063504) has the molecular formula C18H19FN8O and a molecular weight of 382.40 g/mol. Its IUPAC name is 3-[ethyl(methyl)amino]-5-fluoro-2-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one.
| Compound Name | 3-[ethyl(methyl)amino]-5-fluoro-2-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 90063504 |
| Molecular Formula | C18H19FN8O |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-[ethyl(methyl)amino]-5-fluoro-2-[(1S)-1-(7H-purin-6-ylamino)ethyl]quinazolin-4-one |
| SMILES | CCN(C)n1c([C@H](C)Nc2ncnc3nc[nH]c23)nc2cccc(F)c2c1=O |
| InChI | InChI=1S/C18H19FN8O/c1-4-26(3)27-17(25-12-7-5-6-11(19)13(12)18(27)28)10(2)24-16-14-15(21-8-20-14)22-9-23-16/h5-10H,4H2,1-3H3,(H2,20,21,22,23,24)/t10-/m0/s1 |
| InChIKey | ZTJMOLBUGGCPFH-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |