C21H17FN8O — CID 71660372
2-[ethyl-(7H-purin-6-ylamino)amino]-5-fluoro-3-phenylquinazolin-4-one (PubChem CID 71660372) has the molecular formula C21H17FN8O and a molecular weight of 416.42 g/mol. Its IUPAC name is 2-[ethyl-(7H-purin-6-ylamino)amino]-5-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[ethyl-(7H-purin-6-ylamino)amino]-5-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 71660372 |
| Molecular Formula | C21H17FN8O |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[ethyl-(7H-purin-6-ylamino)amino]-5-fluoro-3-phenylquinazolin-4-one |
| SMILES | CCN(Nc1ncnc2nc[nH]c12)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H17FN8O/c1-2-29(28-19-17-18(24-11-23-17)25-12-26-19)21-27-15-10-6-9-14(22)16(15)20(31)30(21)13-7-4-3-5-8-13/h3-12H,2H2,1H3,(H2,23,24,25,26,28) |
| InChIKey | BQTRRWXEZMFYCM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|